C27H32ClF2N7O4 — CID 155624430
2-[4-chloro-2-[[2-[4-[(2R,4R)-2-[(dimethylamino)methyl]-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 155624430) has the molecular formula C27H32ClF2N7O4 and a molecular weight of 592.05 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(2R,4R)-2-[(dimethylamino)methyl]-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(2R,4R)-2-[(dimethylamino)methyl]-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624430 |
| Molecular Formula | C27H32ClF2N7O4 |
| Molecular Weight | 592.05 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(2R,4R)-2-[(dimethylamino)methyl]-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2C[C@H](F)C[C@@H]2CN(C)C)c([N+](=O)[O-])cc1Nc1nccc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C27H32ClF2N7O4/c1-27(2,38)17-9-19(30)18(28)10-20(17)32-25-6-7-31-26(34-25)33-21-11-23(37(39)40)22(12-24(21)41-5)36-13-15(29)8-16(36)14-35(3)4/h6-7,9-12,15-16,38H,8,13-14H2,1-5H3,(H2,31,32,33,34)/t15-,16-/m1/s1 |
| InChIKey | CSODLCNAWGDCNE-HZPDHXFCSA-N |
| XLogP | 5.38 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|