About 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine
1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 155624492) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 155624492 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@H]1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C11H22F2N2/c1-10(2,3)15-8-11(12,13)6-9(15)7-14(4)5/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | YJUZEUWFIHZGRY-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine (CID 155624492) is 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine is CN(C)C[C@H]1CC(F)(F)CN1C(C)(C)C.
What is the InChIKey of 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine?
The InChIKey is YJUZEUWFIHZGRY-SECBINFHSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-10(2,3)15-8-11(12,13)6-9(15)7-14(4)5/h9H,6-8H2,1-5H3/t9-/m1/s1.
What are the key properties of 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine?
1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine has a molecular weight of 220.31 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 155624492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).