C21H22N2O5 — CID 155624540
N-[(7S)-10-amino-1-formyl-2,3-bis(hydroxymethyl)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 155624540) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[(7S)-10-amino-1-formyl-2,3-bis(hydroxymethyl)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S)-10-amino-1-formyl-2,3-bis(hydroxymethyl)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 155624540 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[(7S)-10-amino-1-formyl-2,3-bis(hydroxymethyl)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCc2cc(CO)c(CO)c(C=O)c2-c2ccc(N)c(=O)cc21 |
| InChI | InChI=1S/C21H22N2O5/c1-11(27)23-19-5-2-12-6-13(8-24)16(9-25)17(10-26)21(12)14-3-4-18(22)20(28)7-15(14)19/h3-4,6-7,10,19,24-25H,2,5,8-9H2,1H3,(H2,22,28)(H,23,27)/t19-/m0/s1 |
| InChIKey | VYQJSCRHVSBVSG-IBGZPJMESA-N |
| XLogP | 1.22 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|