About methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium
methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium (PubChem CID 155624841) has the molecular formula C7H12F3NO
and a molecular weight of 183.17 g/mol. Its IUPAC name is methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium.
Molecular Properties
| Compound Name | methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium |
| PubChem CID | 155624841 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium |
| SMILES | [CH2-][NH2+]C(C1CCOC1)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO/c1-11-6(7(8,9)10)5-2-3-12-4-5/h5-6H,1-4,11H2 |
| InChIKey | YYGPMEVGYMAWGJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium?
The IUPAC name of methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium (CID 155624841) is methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium.
What is the SMILES notation for methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium?
The canonical SMILES for methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium is [CH2-][NH2+]C(C1CCOC1)C(F)(F)F.
What is the InChIKey of methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium?
The InChIKey is YYGPMEVGYMAWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO/c1-11-6(7(8,9)10)5-2-3-12-4-5/h5-6H,1-4,11H2.
What are the key properties of methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium?
methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium has a molecular weight of 183.17 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanidyl-[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl]azanium is sourced from PubChem (CID 155624841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).