C30H32IrNO2S- — CID 155626361
2-(4-tert-butyl-2,6-dimethylphenyl)-5-phenylthieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 155626361) has the molecular formula C30H32IrNO2S- and a molecular weight of 662.88 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)-5-phenylthieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-5-phenylthieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 155626361 |
| Molecular Formula | C30H32IrNO2S- |
| Molecular Weight | 662.88 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-5-phenylthieno[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C(C)(C)C)cc(C)c1-c1cc2cc(-c3[c-]cccc3)ncc2s1.[Ir] |
| InChI | InChI=1S/C25H24NS.C5H8O2.Ir/c1-16-11-20(25(3,4)5)12-17(2)24(16)22-14-19-13-21(26-15-23(19)27-22)18-9-7-6-8-10-18;1-4(6)3-5(2)7;/h6-9,11-15H,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WEHBTGJCNMWFBR-LWFKIUJUSA-N |
| XLogP | 8.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|