C29H30IrNO3- — CID 155626772
5-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-2-phenylfuro[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 155626772) has the molecular formula C29H30IrNO3- and a molecular weight of 632.78 g/mol. Its IUPAC name is 5-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-2-phenylfuro[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-2-phenylfuro[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 155626772 |
| Molecular Formula | C29H30IrNO3- |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | 5-(3-tert-butyl-5-methylbenzene-6-id-1-yl)-2-phenylfuro[2,3-c]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1[c-]c(-c2cc3cc(-c4ccccc4)oc3cn2)cc(C(C)(C)C)c1.[Ir] |
| InChI | InChI=1S/C24H22NO.C5H8O2.Ir/c1-16-10-18(12-20(11-16)24(2,3)4)21-13-19-14-22(26-23(19)15-25-21)17-8-6-5-7-9-17;1-4(6)3-5(2)7;/h5-9,11-15H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | QAWNGBNJRFMSFO-LWFKIUJUSA-N |
| XLogP | 7.60 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|