C28H34BFN8O2 — CID 155626884
(1S)-1-(4-fluorophenyl)-1-[2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanamine (PubChem CID 155626884) has the molecular formula C28H34BFN8O2 and a molecular weight of 544.44 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-1-[2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanamine.
| Compound Name | (1S)-1-(4-fluorophenyl)-1-[2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 155626884 |
| Molecular Formula | C28H34BFN8O2 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-1-[2-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]piperazin-1-yl]pyrimidin-5-yl]ethanamine |
| SMILES | CC1(C)OB(c2cc3c(N4CCN(c5ncc([C@@](C)(N)c6ccc(F)cc6)cn5)CC4)ncnn3c2)OC1(C)C |
| InChI | InChI=1S/C28H34BFN8O2/c1-26(2)27(3,4)40-29(39-26)21-14-23-24(34-18-35-38(23)17-21)36-10-12-37(13-11-36)25-32-15-20(16-33-25)28(5,31)19-6-8-22(30)9-7-19/h6-9,14-18H,10-13,31H2,1-5H3/t28-/m0/s1 |
| InChIKey | NLNDDPPILVAYFV-NDEPHWFRSA-N |
| XLogP | 2.51 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|