About 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide
2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide (PubChem CID 155627074) has the molecular formula C13H22F2N2O
and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide |
| PubChem CID | 155627074 |
| Molecular Formula | C13H22F2N2O |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)C1CCCN1C(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C13H22F2N2O/c1-12(2,3)10-5-4-6-17(10)11(18)16-9-7-13(14,15)8-9/h9-10H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | KSPQBKFLSGDNDP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide?
The IUPAC name of 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide (CID 155627074) is 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide?
The canonical SMILES for 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide is CC(C)(C)C1CCCN1C(=O)NC1CC(F)(F)C1.
What is the InChIKey of 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide?
The InChIKey is KSPQBKFLSGDNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2N2O/c1-12(2,3)10-5-4-6-17(10)11(18)16-9-7-13(14,15)8-9/h9-10H,4-8H2,1-3H3,(H,16,18).
What are the key properties of 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide?
2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide has a molecular weight of 260.33 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-(3,3-difluorocyclobutyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 155627074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).