About (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide
(2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide (PubChem CID 155627087) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide |
| PubChem CID | 155627087 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C10H18F2N2O/c1-9(2,3)14-6-10(11,12)5-7(14)8(15)13-4/h7H,5-6H2,1-4H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | UQDPMJURIYLBCT-SSDOTTSWSA-N |
| XLogP | 1.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide?
The IUPAC name of (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide (CID 155627087) is (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide.
What is the SMILES notation for (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide?
The canonical SMILES for (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide is CNC(=O)[C@H]1CC(F)(F)CN1C(C)(C)C.
What is the InChIKey of (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide?
The InChIKey is UQDPMJURIYLBCT-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-9(2,3)14-6-10(11,12)5-7(14)8(15)13-4/h7H,5-6H2,1-4H3,(H,13,15)/t7-/m1/s1.
What are the key properties of (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide?
(2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide has a molecular weight of 220.26 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-tert-butyl-4,4-difluoro-N-methylpyrrolidine-2-carboxamide is sourced from PubChem (CID 155627087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).