C15H25BN4O6 — CID 155627333
(3R,4S)-3-amino-1-[2-(2-aminopropylamino)-3,4-dioxocyclobuten-1-yl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 155627333) has the molecular formula C15H25BN4O6 and a molecular weight of 368.20 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-(2-aminopropylamino)-3,4-dioxocyclobuten-1-yl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-(2-aminopropylamino)-3,4-dioxocyclobuten-1-yl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627333 |
| Molecular Formula | C15H25BN4O6 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-(2-aminopropylamino)-3,4-dioxocyclobuten-1-yl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(N)CNc1c(N2C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C2)c(=O)c1=O |
| InChI | InChI=1S/C15H25BN4O6/c1-8(17)5-19-10-11(13(22)12(10)21)20-6-9(3-2-4-16(25)26)15(18,7-20)14(23)24/h8-9,19,25-26H,2-7,17-18H2,1H3,(H,23,24)/t8?,9-,15-/m0/s1 |
| InChIKey | WFRHFBLQCLTXCQ-NHJYYFCCSA-N |
| XLogP | -2.49 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|