C16H9F5N2O3S — CID 155627537
2,2-difluoro-4-(5-isocyano-3-pyridinyl)-7-(trifluoromethylsulfonyl)-1,3-dihydroinden-1-ol (PubChem CID 155627537) has the molecular formula C16H9F5N2O3S and a molecular weight of 404.32 g/mol. Its IUPAC name is 2,2-difluoro-4-(5-isocyano-3-pyridinyl)-7-(trifluoromethylsulfonyl)-1,3-dihydroinden-1-ol.
| Compound Name | 2,2-difluoro-4-(5-isocyano-3-pyridinyl)-7-(trifluoromethylsulfonyl)-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 155627537 |
| Molecular Formula | C16H9F5N2O3S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2,2-difluoro-4-(5-isocyano-3-pyridinyl)-7-(trifluoromethylsulfonyl)-1,3-dihydroinden-1-ol |
| SMILES | [C-]#[N+]c1cncc(-c2ccc(S(=O)(=O)C(F)(F)F)c3c2CC(F)(F)C3O)c1 |
| InChI | InChI=1S/C16H9F5N2O3S/c1-22-9-4-8(6-23-7-9)10-2-3-12(27(25,26)16(19,20)21)13-11(10)5-15(17,18)14(13)24/h2-4,6-7,14,24H,5H2 |
| InChIKey | DMXGHRZYCQUQBU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|