C22H26FN5O3S — CID 155627816
1-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]-3-[(1-methylpyrrolidin-3-yl)methylsulfonyl]urea (PubChem CID 155627816) has the molecular formula C22H26FN5O3S and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]-3-[(1-methylpyrrolidin-3-yl)methylsulfonyl]urea.
| Compound Name | 1-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]-3-[(1-methylpyrrolidin-3-yl)methylsulfonyl]urea |
|---|---|
| PubChem CID | 155627816 |
| Molecular Formula | C22H26FN5O3S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]-3-[(1-methylpyrrolidin-3-yl)methylsulfonyl]urea |
| SMILES | [C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2NC(=O)NS(=O)(=O)CC2CCN(C)C2)ccn1 |
| InChI | InChI=1S/C22H26FN5O3S/c1-14(2)18-10-17(23)11-19(16-5-7-25-20(9-16)24-3)21(18)26-22(29)27-32(30,31)13-15-6-8-28(4)12-15/h5,7,9-11,14-15H,6,8,12-13H2,1-2,4H3,(H2,26,27,29) |
| InChIKey | GHGHPGQCLBFIOF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|