C37H34BF2N11O9P — CID 155627842
CID 155627842 (PubChem CID 155627842) has the molecular formula C37H34BF2N11O9P and a molecular weight of 856.53 g/mol.
| Compound Name | CID 155627842 |
|---|---|
| PubChem CID | 155627842 |
| Molecular Formula | C37H34BF2N11O9P |
| Molecular Weight | 856.53 g/mol |
| Exact Mass | 856.23 |
| IUPAC Name | — |
| SMILES | [B-][P+](OCC[N+]#[C-])(OCC1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C(O)C1F)O[C@@H]1C(F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C37H33BF2N11O9P/c1-41-12-13-56-61(38,57-15-23-24(39)28(53)37(59-23)51-19-47-27-31(43-17-45-33(27)51)49-35(55)21-10-6-3-7-11-21)60-29-22(14-52)58-36(25(29)40)50-18-46-26-30(42-16-44-32(26)50)48-34(54)20-8-4-2-5-9-20/h2-11,16-19,22-25,28-29,36-37,52-53H,12-15H2,(H-,42,43,44,45,48,49,54,55)/q-1/p+1/t22-,23?,24?,25?,28?,29+,36-,37?,61?/m1/s1 |
| InChIKey | NQXHAKCHLPBIMQ-IYEBOBDPSA-O |
| XLogP | 3.18 |
| TPSA | 236.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|