About methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate
methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate (PubChem CID 155628475) has the molecular formula C11H22N2O3S2Si
and a molecular weight of 322.53 g/mol. Its IUPAC name is methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate.
Molecular Properties
| Compound Name | methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate |
| PubChem CID | 155628475 |
| Molecular Formula | C11H22N2O3S2Si |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate |
| SMILES | CSC(=S)NCCC[Si]12OCCN(CCO1)CCO2 |
| InChI | InChI=1S/C11H22N2O3S2Si/c1-18-11(17)12-3-2-10-19-14-7-4-13(5-8-15-19)6-9-16-19/h2-10H2,1H3,(H,12,17) |
| InChIKey | LSIGVPHLDYTXQU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate?
The IUPAC name of methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate (CID 155628475) is methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate.
What is the SMILES notation for methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate?
The canonical SMILES for methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate is CSC(=S)NCCC[Si]12OCCN(CCO1)CCO2.
What is the InChIKey of methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate?
The InChIKey is LSIGVPHLDYTXQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S2Si/c1-18-11(17)12-3-2-10-19-14-7-4-13(5-8-15-19)6-9-16-19/h2-10H2,1H3,(H,12,17).
What are the key properties of methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate?
methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate has a molecular weight of 322.53 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbamodithioate is sourced from PubChem (CID 155628475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).