About CID 155629314
CID 155629314 (PubChem CID 155629314) has the molecular formula C11H11N3O3Sn
and a molecular weight of 351.94 g/mol.
Molecular Properties
| Compound Name | CID 155629314 |
| PubChem CID | 155629314 |
| Molecular Formula | C11H11N3O3Sn |
| Molecular Weight | 351.94 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | — |
| SMILES | COc1ncc2c(C)c(C(C)=O)c(=O)[nH]c2n1.[Sn] |
| InChI | InChI=1S/C11H11N3O3.Sn/c1-5-7-4-12-11(17-3)14-9(7)13-10(16)8(5)6(2)15;/h4H,1-3H3,(H,12,13,14,16); |
| InChIKey | MWNYAFFYTVFHAD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.94 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 155629314 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155629314?
The IUPAC name of CID 155629314 (CID 155629314) is not available.
What is the SMILES notation for CID 155629314?
The canonical SMILES for CID 155629314 is COc1ncc2c(C)c(C(C)=O)c(=O)[nH]c2n1.[Sn].
What is the InChIKey of CID 155629314?
The InChIKey is MWNYAFFYTVFHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3.Sn/c1-5-7-4-12-11(17-3)14-9(7)13-10(16)8(5)6(2)15;/h4H,1-3H3,(H,12,13,14,16);.
What are the key properties of CID 155629314?
CID 155629314 has a molecular weight of 351.94 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155629314 is sourced from PubChem (CID 155629314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).