About CID 155629464
CID 155629464 (PubChem CID 155629464) has the molecular formula C26H62Cl4N2SSi6
and a molecular weight of 745.19 g/mol.
Molecular Properties
| Compound Name | CID 155629464 |
| PubChem CID | 155629464 |
| Molecular Formula | C26H62Cl4N2SSi6 |
| Molecular Weight | 745.19 g/mol |
| Exact Mass | 742.20 |
| IUPAC Name | — |
| SMILES | CC(CCCN([Si](C)(C)C)[Si](C)(C)C)(CCSCCC(C)(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](Cl)Cl)[Si](Cl)Cl |
| InChI | InChI=1S/C26H62Cl4N2SSi6/c1-25(34(27)28,17-15-21-31(36(3,4)5)37(6,7)8)19-23-33-24-20-26(2,35(29)30)18-16-22-32(38(9,10)11)39(12,13)14/h15-24H2,1-14H3 |
| InChIKey | JIKQQCUYJWOVRW-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 745.19 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 155629464 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155629464?
The IUPAC name of CID 155629464 (CID 155629464) is not available.
What is the SMILES notation for CID 155629464?
The canonical SMILES for CID 155629464 is CC(CCCN([Si](C)(C)C)[Si](C)(C)C)(CCSCCC(C)(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](Cl)Cl)[Si](Cl)Cl.
What is the InChIKey of CID 155629464?
The InChIKey is JIKQQCUYJWOVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H62Cl4N2SSi6/c1-25(34(27)28,17-15-21-31(36(3,4)5)37(6,7)8)19-23-33-24-20-26(2,35(29)30)18-16-22-32(38(9,10)11)39(12,13)14/h15-24H2,1-14H3.
What are the key properties of CID 155629464?
CID 155629464 has a molecular weight of 745.19 g/mol, XLogP of 11.46, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155629464 is sourced from PubChem (CID 155629464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).