About CID 155629584
CID 155629584 (PubChem CID 155629584) has the molecular formula C11H17O2SSi
and a molecular weight of 241.41 g/mol.
Molecular Properties
| Compound Name | CID 155629584 |
| PubChem CID | 155629584 |
| Molecular Formula | C11H17O2SSi |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)c1cc(C)ccc1S |
| InChI | InChI=1S/C11H17O2SSi/c1-4-12-15(13-5-2)11-8-9(3)6-7-10(11)14/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | HHDFKCSRVJQNSZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 155629584 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155629584?
The IUPAC name of CID 155629584 (CID 155629584) is not available.
What is the SMILES notation for CID 155629584?
The canonical SMILES for CID 155629584 is CCO[Si](OCC)c1cc(C)ccc1S.
What is the InChIKey of CID 155629584?
The InChIKey is HHDFKCSRVJQNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O2SSi/c1-4-12-15(13-5-2)11-8-9(3)6-7-10(11)14/h6-8,14H,4-5H2,1-3H3.
What are the key properties of CID 155629584?
CID 155629584 has a molecular weight of 241.41 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155629584 is sourced from PubChem (CID 155629584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).