About CID 155629602
CID 155629602 (PubChem CID 155629602) has the molecular formula C17H51O13Si11
and a molecular weight of 772.53 g/mol.
Molecular Properties
| Compound Name | CID 155629602 |
| PubChem CID | 155629602 |
| Molecular Formula | C17H51O13Si11 |
| Molecular Weight | 772.53 g/mol |
| Exact Mass | 771.08 |
| IUPAC Name | — |
| SMILES | CO[Si]O[Si](O[Si]OC)(O[Si]OC)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)C |
| InChI | InChI=1S/C17H51O13Si11/c1-18-31-21-41(22-32-19-2,23-33-20-3)30-40(16,17)29-39(14,15)28-38(12,13)27-37(10,11)26-36(8,9)25-35(6,7)24-34(4)5/h1-17H3 |
| InChIKey | MXUHOCPALZORHF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 772.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155629602 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155629602?
The IUPAC name of CID 155629602 (CID 155629602) is not available.
What is the SMILES notation for CID 155629602?
The canonical SMILES for CID 155629602 is CO[Si]O[Si](O[Si]OC)(O[Si]OC)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)C.
What is the InChIKey of CID 155629602?
The InChIKey is MXUHOCPALZORHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H51O13Si11/c1-18-31-21-41(22-32-19-2,23-33-20-3)30-40(16,17)29-39(14,15)28-38(12,13)27-37(10,11)26-36(8,9)25-35(6,7)24-34(4)5/h1-17H3.
What are the key properties of CID 155629602?
CID 155629602 has a molecular weight of 772.53 g/mol, XLogP of 3.59, 23 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155629602 is sourced from PubChem (CID 155629602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).