C19H19N8O2+ — CID 155629824
2-(2-methoxyethyl)-8-(3-methylimidazo[1,2-a]pyridin-6-yl)-7-(1,2-oxazol-2-ium-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 155629824) has the molecular formula C19H19N8O2+ and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-8-(3-methylimidazo[1,2-a]pyridin-6-yl)-7-(1,2-oxazol-2-ium-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 2-(2-methoxyethyl)-8-(3-methylimidazo[1,2-a]pyridin-6-yl)-7-(1,2-oxazol-2-ium-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 155629824 |
| Molecular Formula | C19H19N8O2+ |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(2-methoxyethyl)-8-(3-methylimidazo[1,2-a]pyridin-6-yl)-7-(1,2-oxazol-2-ium-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COCCc1nc2c(-c3ccc4ncc(C)n4c3)c(-[n+]3ccco3)nc(N)n2n1 |
| InChI | InChI=1S/C19H19N8O2/c1-12-10-21-15-5-4-13(11-25(12)15)16-17(26-7-3-8-29-26)23-19(20)27-18(16)22-14(24-27)6-9-28-2/h3-5,7-8,10-11H,6,9H2,1-2H3,(H2,20,23)/q+1 |
| InChIKey | VZMZIVWUZFKMTB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|