About (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane
(4S)-4,8-dimethyl-1-oxaspiro[4.5]decane (PubChem CID 155629852) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane |
| PubChem CID | 155629852 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane |
| SMILES | CC1CCC2(CC1)OCC[C@@H]2C |
| InChI | InChI=1S/C11H20O/c1-9-3-6-11(7-4-9)10(2)5-8-12-11/h9-10H,3-8H2,1-2H3/t9?,10-,11?/m0/s1 |
| InChIKey | JPPUBUDZRFHSLW-YVNMAJEFSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane?
The IUPAC name of (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane (CID 155629852) is (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane.
What is the SMILES notation for (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane?
The canonical SMILES for (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane is CC1CCC2(CC1)OCC[C@@H]2C.
What is the InChIKey of (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane?
The InChIKey is JPPUBUDZRFHSLW-YVNMAJEFSA-N. The full InChI is InChI=1S/C11H20O/c1-9-3-6-11(7-4-9)10(2)5-8-12-11/h9-10H,3-8H2,1-2H3/t9?,10-,11?/m0/s1.
What are the key properties of (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane?
(4S)-4,8-dimethyl-1-oxaspiro[4.5]decane has a molecular weight of 168.28 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,8-dimethyl-1-oxaspiro[4.5]decane is sourced from PubChem (CID 155629852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).