C15H17ClFN5O2 — CID 155630280
7-chloro-8-fluoro-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 155630280) has the molecular formula C15H17ClFN5O2 and a molecular weight of 353.79 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-8-fluoro-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155630280 |
| Molecular Formula | C15H17ClFN5O2 |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 7-chloro-8-fluoro-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(OCCCN2C[C@@H]3C[C@H]2CO3)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C15H17ClFN5O2/c16-13-11(17)12-10(5-19-13)14(18)21-15(20-12)23-3-1-2-22-6-9-4-8(22)7-24-9/h5,8-9H,1-4,6-7H2,(H2,18,20,21)/t8-,9-/m0/s1 |
| InChIKey | JVUIVJGALKENKL-IUCAKERBSA-N |
| XLogP | 1.64 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|