C9H20NO10P — CID 155630587
[(2S,4S,5S)-6-[(1R)-2-(2-aminoethoxy)-1-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate (PubChem CID 155630587) has the molecular formula C9H20NO10P and a molecular weight of 333.23 g/mol. Its IUPAC name is [(2S,4S,5S)-6-[(1R)-2-(2-aminoethoxy)-1-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate.
| Compound Name | [(2S,4S,5S)-6-[(1R)-2-(2-aminoethoxy)-1-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155630587 |
| Molecular Formula | C9H20NO10P |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(2S,4S,5S)-6-[(1R)-2-(2-aminoethoxy)-1-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
| SMILES | NCCOC[C@@H](O)C1O[C@@H](OP(=O)(O)O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H20NO10P/c10-1-2-18-3-4(11)8-6(13)5(12)7(14)9(19-8)20-21(15,16)17/h4-9,11-14H,1-3,10H2,(H2,15,16,17)/t4-,5+,6+,7?,8?,9+/m1/s1 |
| InChIKey | CYCFNGMCPPEHRQ-NKLIKSPUSA-N |
| XLogP | -3.76 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|