C14H16ClN3O — CID 155631303
(3aR,6aR)-5-(6-chloroimidazo[1,5-a]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 155631303) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is (3aR,6aR)-5-(6-chloroimidazo[1,5-a]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aR)-5-(6-chloroimidazo[1,5-a]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 155631303 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (3aR,6aR)-5-(6-chloroimidazo[1,5-a]pyridin-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | OC1(c2c(Cl)ccc3cncn23)C[C@H]2CNC[C@@H]2C1 |
| InChI | InChI=1S/C14H16ClN3O/c15-12-2-1-11-7-17-8-18(11)13(12)14(19)3-9-5-16-6-10(9)4-14/h1-2,7-10,16,19H,3-6H2/t9-,10-/m0/s1 |
| InChIKey | NWAPVDSXWSJFTA-UWVGGRQHSA-N |
| XLogP | 1.80 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |