C31H31Cl2N3O2S — CID 155631346
5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[(1R,5S)-8-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-8-azabicyclo[3.2.1]octan-3-yl]oxymethyl]-1,2-oxazole (PubChem CID 155631346) has the molecular formula C31H31Cl2N3O2S and a molecular weight of 580.58 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[(1R,5S)-8-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-8-azabicyclo[3.2.1]octan-3-yl]oxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[(1R,5S)-8-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-8-azabicyclo[3.2.1]octan-3-yl]oxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 155631346 |
| Molecular Formula | C31H31Cl2N3O2S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[(1R,5S)-8-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-8-azabicyclo[3.2.1]octan-3-yl]oxymethyl]-1,2-oxazole |
| SMILES | Cc1ccc(-c2csc(N3[C@@H]4CC[C@H]3CC(OCc3c(-c5c(Cl)cccc5Cl)noc3C3CC3)C4)n2)c(C)c1 |
| InChI | InChI=1S/C31H31Cl2N3O2S/c1-17-6-11-23(18(2)12-17)27-16-39-31(34-27)36-20-9-10-21(36)14-22(13-20)37-15-24-29(35-38-30(24)19-7-8-19)28-25(32)4-3-5-26(28)33/h3-6,11-12,16,19-22H,7-10,13-15H2,1-2H3/t20-,21+,22? |
| InChIKey | RJFXKHIRFKLLMW-CBQGHPETSA-N |
| XLogP | 8.98 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |