C31H32F4O7S2 — CID 155631882
ethyl 3-[1,1,2,2-tetrafluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl]-1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 155631882) has the molecular formula C31H32F4O7S2 and a molecular weight of 656.72 g/mol. Its IUPAC name is ethyl 3-[1,1,2,2-tetrafluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl]-1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl 3-[1,1,2,2-tetrafluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl]-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155631882 |
| Molecular Formula | C31H32F4O7S2 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | ethyl 3-[1,1,2,2-tetrafluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl]-1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)C1CCC2(CC1)OCC(C(F)(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)O2 |
| InChI | InChI=1S/C31H32F4O7S2/c1-2-39-28(36)23-18-20-29(21-19-23)40-22-27(41-29)30(32,33)31(34,35)44(37,38)42-43(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-17,23,27H,2,18-22H2,1H3 |
| InChIKey | FAMAYZVSYTWZKQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|