C21H29F2N5O2Si — CID 155632639
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(3,5-difluoro-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 155632639) has the molecular formula C21H29F2N5O2Si and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(3,5-difluoro-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(3,5-difluoro-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155632639 |
| Molecular Formula | C21H29F2N5O2Si |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(3,5-difluoro-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)N2CCN(c3ncc(F)cc3F)CC2)nc1 |
| InChI | InChI=1S/C21H29F2N5O2Si/c1-21(2,3)31(4,5)30-16-6-7-18(24-14-16)26-20(29)28-10-8-27(9-11-28)19-17(23)12-15(22)13-25-19/h6-7,12-14H,8-11H2,1-5H3,(H,24,26,29) |
| InChIKey | HWNNEIISAVOEHI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|