About 2-benzyl-5-phenyl-1,2,4-triazol-3-amine
2-benzyl-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 15563286) has the molecular formula C15H14N4
and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-benzyl-5-phenyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-benzyl-5-phenyl-1,2,4-triazol-3-amine |
| PubChem CID | 15563286 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-benzyl-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | Nc1nc(-c2ccccc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C15H14N4/c16-15-17-14(13-9-5-2-6-10-13)18-19(15)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,16,17,18) |
| InChIKey | BMGQCYDKLFQJFJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-5-phenyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-phenyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-benzyl-5-phenyl-1,2,4-triazol-3-amine (CID 15563286) is 2-benzyl-5-phenyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-benzyl-5-phenyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-benzyl-5-phenyl-1,2,4-triazol-3-amine is Nc1nc(-c2ccccc2)nn1Cc1ccccc1.
What is the InChIKey of 2-benzyl-5-phenyl-1,2,4-triazol-3-amine?
The InChIKey is BMGQCYDKLFQJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4/c16-15-17-14(13-9-5-2-6-10-13)18-19(15)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,16,17,18).
What are the key properties of 2-benzyl-5-phenyl-1,2,4-triazol-3-amine?
2-benzyl-5-phenyl-1,2,4-triazol-3-amine has a molecular weight of 250.31 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-phenyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 15563286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).