About CID 155633235
CID 155633235 (PubChem CID 155633235) has the molecular formula HBCl2P
and a molecular weight of 114.71 g/mol.
Molecular Properties
| Compound Name | CID 155633235 |
| PubChem CID | 155633235 |
| Molecular Formula | HBCl2P |
| Molecular Weight | 114.71 g/mol |
| Exact Mass | 113.93 |
| IUPAC Name | — |
| SMILES | [2H][B]P(Cl)Cl |
| InChI | InChI=1S/BCl2HP/c1-4(2)3/h1H/i1D |
| InChIKey | POOYGJHYEBNCAW-MICDWDOJSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 155633235 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155633235?
The IUPAC name of CID 155633235 (CID 155633235) is not available.
What is the SMILES notation for CID 155633235?
The canonical SMILES for CID 155633235 is [2H][B]P(Cl)Cl.
What is the InChIKey of CID 155633235?
The InChIKey is POOYGJHYEBNCAW-MICDWDOJSA-N. The full InChI is InChI=1S/BCl2HP/c1-4(2)3/h1H/i1D.
What are the key properties of CID 155633235?
CID 155633235 has a molecular weight of 114.71 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155633235 is sourced from PubChem (CID 155633235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).