C27H40F2N6O3Si — CID 155634545
tert-butyl (3R)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 155634545) has the molecular formula C27H40F2N6O3Si and a molecular weight of 562.74 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155634545 |
| Molecular Formula | C27H40F2N6O3Si |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | tert-butyl (3R)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c(-c3ccn(C(F)F)n3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C27H40F2N6O3Si/c1-27(2,3)38-26(36)33-11-7-8-19(17-33)31-23-20-9-12-34(18-37-14-15-39(4,5)6)24(20)30-16-21(23)22-10-13-35(32-22)25(28)29/h9-10,12-13,16,19,25H,7-8,11,14-15,17-18H2,1-6H3,(H,30,31)/t19-/m1/s1 |
| InChIKey | PEICROCUXDSUQW-LJQANCHMSA-N |
| XLogP | 6.42 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|