C28H42N6O5SSi — CID 155634562
tert-butyl (3R)-3-[[5-(2-methylsulfonylpyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 155634562) has the molecular formula C28H42N6O5SSi and a molecular weight of 602.83 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-(2-methylsulfonylpyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-(2-methylsulfonylpyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155634562 |
| Molecular Formula | C28H42N6O5SSi |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | tert-butyl (3R)-3-[[5-(2-methylsulfonylpyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c(-c3ccnc(S(C)(=O)=O)n3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C28H42N6O5SSi/c1-28(2,3)39-27(35)33-13-8-9-20(18-33)31-24-21-11-14-34(19-38-15-16-41(5,6)7)25(21)30-17-22(24)23-10-12-29-26(32-23)40(4,36)37/h10-12,14,17,20H,8-9,13,15-16,18-19H2,1-7H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | CDPGDBDRWDETQD-HXUWFJFHSA-N |
| XLogP | 5.02 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|