C30H39N5O4Si — CID 155634594
benzyl 3-methyl-5-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 155634594) has the molecular formula C30H39N5O4Si and a molecular weight of 561.76 g/mol. Its IUPAC name is benzyl 3-methyl-5-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | benzyl 3-methyl-5-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155634594 |
| Molecular Formula | C30H39N5O4Si |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | benzyl 3-methyl-5-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CC1CC(Nc2c(-c3ncco3)cnc3c2ccn3COCC[Si](C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C30H39N5O4Si/c1-22-16-24(19-35(18-22)30(36)39-20-23-8-6-5-7-9-23)33-27-25-10-12-34(21-37-14-15-40(2,3)4)28(25)32-17-26(27)29-31-11-13-38-29/h5-13,17,22,24H,14-16,18-21H2,1-4H3,(H,32,33) |
| InChIKey | HZRAJUSMGDBFTJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|