C28H38N4O5Si — CID 155634604
4-[[(3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid (PubChem CID 155634604) has the molecular formula C28H38N4O5Si and a molecular weight of 538.72 g/mol. Its IUPAC name is 4-[[(3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 4-[[(3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 155634604 |
| Molecular Formula | C28H38N4O5Si |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 4-[[(3R,5S)-5-methyl-1-phenylmethoxycarbonylpiperidin-3-yl]amino]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| SMILES | C[C@H]1C[C@@H](Nc2c(C(=O)O)cnc3c2ccn3COCC[Si](C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H38N4O5Si/c1-20-14-22(17-32(16-20)28(35)37-18-21-8-6-5-7-9-21)30-25-23-10-11-31(19-36-12-13-38(2,3)4)26(23)29-15-24(25)27(33)34/h5-11,15,20,22H,12-14,16-19H2,1-4H3,(H,29,30)(H,33,34)/t20-,22+/m0/s1 |
| InChIKey | ATISGHMPWKQOHE-RBBKRZOGSA-N |
| XLogP | 5.51 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|