C31H40F2N6O3Si — CID 155634609
benzyl (3R,5S)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]-5-methylpiperidine-1-carboxylate (PubChem CID 155634609) has the molecular formula C31H40F2N6O3Si and a molecular weight of 610.78 g/mol. Its IUPAC name is benzyl (3R,5S)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]-5-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (3R,5S)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155634609 |
| Molecular Formula | C31H40F2N6O3Si |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | benzyl (3R,5S)-3-[[5-[1-(difluoromethyl)pyrazol-3-yl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]-5-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](Nc2c(-c3ccn(C(F)F)n3)cnc3c2ccn3COCC[Si](C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C31H40F2N6O3Si/c1-22-16-24(19-38(18-22)31(40)42-20-23-8-6-5-7-9-23)35-28-25-10-12-37(21-41-14-15-43(2,3)4)29(25)34-17-26(28)27-11-13-39(36-27)30(32)33/h5-13,17,22,24,30H,14-16,18-21H2,1-4H3,(H,34,35)/t22-,24+/m0/s1 |
| InChIKey | XEQBJHGMJLBGBE-LADGPHEKSA-N |
| XLogP | 7.07 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|