C21H30N4O3Si — CID 155634630
cis-(1S,3R)-3-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentan-1-ol (PubChem CID 155634630) has the molecular formula C21H30N4O3Si and a molecular weight of 414.58 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | cis-(1S,3R)-3-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 155634630 |
| Molecular Formula | C21H30N4O3Si |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | cis-(1S,3R)-3-[[5-(1,3-oxazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(N[C@@H]3CC[C@H](O)C3)c(-c3ncco3)cnc21 |
| InChI | InChI=1S/C21H30N4O3Si/c1-29(2,3)11-10-27-14-25-8-6-17-19(24-15-4-5-16(26)12-15)18(13-23-20(17)25)21-22-7-9-28-21/h6-9,13,15-16,26H,4-5,10-12,14H2,1-3H3,(H,23,24)/t15-,16+/m1/s1 |
| InChIKey | GYACKMGNTLOKMO-CVEARBPZSA-N |
| XLogP | 4.33 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|