C14H19OS+ — CID 155635542
4-phenyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxathiin-4-ium (PubChem CID 155635542) has the molecular formula C14H19OS+ and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-phenyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxathiin-4-ium.
| Compound Name | 4-phenyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxathiin-4-ium |
|---|---|
| PubChem CID | 155635542 |
| Molecular Formula | C14H19OS+ |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-phenyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxathiin-4-ium |
| SMILES | c1ccc([S+]2CCOC3CCCCC32)cc1 |
| InChI | InChI=1S/C14H19OS/c1-2-6-12(7-3-1)16-11-10-15-13-8-4-5-9-14(13)16/h1-3,6-7,13-14H,4-5,8-11H2/q+1 |
| InChIKey | PJKBCDXLCLPJRH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|