C13H7N3OS — CID 155635630
6-(4-isocyanophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 155635630) has the molecular formula C13H7N3OS and a molecular weight of 253.29 g/mol. Its IUPAC name is 6-(4-isocyanophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(4-isocyanophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 155635630 |
| Molecular Formula | C13H7N3OS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 6-(4-isocyanophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | [C-]#[N+]c1ccc(-c2nc3sccn3c2C=O)cc1 |
| InChI | InChI=1S/C13H7N3OS/c1-14-10-4-2-9(3-5-10)12-11(8-17)16-6-7-18-13(16)15-12/h2-8H |
| InChIKey | OVDUDDOFOPYSOX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|