C33H26N4O — CID 155635938
9-(4-tert-butyl-2-pyridinyl)-7-(3-pyridin-2-ylphenoxy)carbazole-3-carbonitrile (PubChem CID 155635938) has the molecular formula C33H26N4O and a molecular weight of 494.60 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-7-(3-pyridin-2-ylphenoxy)carbazole-3-carbonitrile.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-7-(3-pyridin-2-ylphenoxy)carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155635938 |
| Molecular Formula | C33H26N4O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-7-(3-pyridin-2-ylphenoxy)carbazole-3-carbonitrile |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccc(C#N)cc3c3ccc(Oc4cccc(-c5ccccn5)c4)cc32)c1 |
| InChI | InChI=1S/C33H26N4O/c1-33(2,3)24-14-16-36-32(19-24)37-30-13-10-22(21-34)17-28(30)27-12-11-26(20-31(27)37)38-25-8-6-7-23(18-25)29-9-4-5-15-35-29/h4-20H,1-3H3 |
| InChIKey | INZIFPOWTAQCNZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |