C28H24ClN5O4 — CID 155636894
1-[4-[4-[4-chloro-3-(1,3-oxazol-5-yl)anilino]-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 155636894) has the molecular formula C28H24ClN5O4 and a molecular weight of 529.98 g/mol. Its IUPAC name is 1-[4-[4-[4-chloro-3-(1,3-oxazol-5-yl)anilino]-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-chloro-3-(1,3-oxazol-5-yl)anilino]-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155636894 |
| Molecular Formula | C28H24ClN5O4 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 1-[4-[4-[4-chloro-3-(1,3-oxazol-5-yl)anilino]-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]c1cnc2cc(OC)c(OC3CCN(C(=O)C=C)CC3)cc2c1Nc1ccc(Cl)c(-c2cnco2)c1 |
| InChI | InChI=1S/C28H24ClN5O4/c1-4-27(35)34-9-7-18(8-10-34)38-25-12-20-22(13-24(25)36-3)32-14-23(30-2)28(20)33-17-5-6-21(29)19(11-17)26-15-31-16-37-26/h4-6,11-16,18H,1,7-10H2,3H3,(H,32,33) |
| InChIKey | XXIHBSFWWUFNGB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|