C39H44BNO — CID 155637072
6,11,17-tritert-butyl-24-propan-2-yl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaene (PubChem CID 155637072) has the molecular formula C39H44BNO and a molecular weight of 553.60 g/mol. Its IUPAC name is 6,11,17-tritert-butyl-24-propan-2-yl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaene.
| Compound Name | 6,11,17-tritert-butyl-24-propan-2-yl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaene |
|---|---|
| PubChem CID | 155637072 |
| Molecular Formula | C39H44BNO |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | 6,11,17-tritert-butyl-24-propan-2-yl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaene |
| SMILES | CC(C)c1cc2c3c(c1)-n1c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)cc(c41)B3c1cc(C(C)(C)C)ccc1O2 |
| InChI | InChI=1S/C39H44BNO/c1-22(2)23-16-32-35-34(17-23)42-33-15-13-25(38(6,7)8)20-29(33)40(35)30-21-26(39(9,10)11)19-28-27-18-24(37(3,4)5)12-14-31(27)41(32)36(28)30/h12-22H,1-11H3 |
| InChIKey | GKJFDBCTNKFJMG-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|