C45H37BN2O — CID 155637393
4-(6,11-ditert-butyl-18-phenyl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaen-24-yl)benzonitrile (PubChem CID 155637393) has the molecular formula C45H37BN2O and a molecular weight of 632.62 g/mol. Its IUPAC name is 4-(6,11-ditert-butyl-18-phenyl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaen-24-yl)benzonitrile.
| Compound Name | 4-(6,11-ditert-butyl-18-phenyl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaen-24-yl)benzonitrile |
|---|---|
| PubChem CID | 155637393 |
| Molecular Formula | C45H37BN2O |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 4-(6,11-ditert-butyl-18-phenyl-21-oxa-2-aza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(26),3(8),4,6,9(27),10,12,15(20),16,18,22,24-dodecaen-24-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)cc3c1n2-c1cc(-c2ccc(C#N)cc2)cc2c1B3c1ccc(-c3ccccc3)cc1O2 |
| InChI | InChI=1S/C45H37BN2O/c1-44(2,3)32-17-19-38-34(23-32)35-24-33(45(4,5)6)25-37-43(35)48(38)39-20-31(29-14-12-27(26-47)13-15-29)22-41-42(39)46(37)36-18-16-30(21-40(36)49-41)28-10-8-7-9-11-28/h7-25H,1-6H3 |
| InChIKey | LWAPQAPXZBQERI-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|