C22H24FN5O4S — CID 155639595
3,3,3-trideuterio-1-[6-[[6-fluoro-5-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-2-pyridinyl]amino]-4-[(3-methylsulfonyl-2-pyridinyl)amino]-3-pyridinyl]propan-1-one (PubChem CID 155639595) has the molecular formula C22H24FN5O4S and a molecular weight of 482.58 g/mol. Its IUPAC name is 3,3,3-trideuterio-1-[6-[[6-fluoro-5-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-2-pyridinyl]amino]-4-[(3-methylsulfonyl-2-pyridinyl)amino]-3-pyridinyl]propan-1-one.
| Compound Name | 3,3,3-trideuterio-1-[6-[[6-fluoro-5-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-2-pyridinyl]amino]-4-[(3-methylsulfonyl-2-pyridinyl)amino]-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 155639595 |
| Molecular Formula | C22H24FN5O4S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3,3,3-trideuterio-1-[6-[[6-fluoro-5-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-2-pyridinyl]amino]-4-[(3-methylsulfonyl-2-pyridinyl)amino]-3-pyridinyl]propan-1-one |
| SMILES | [2H]C([2H])([2H])CC(=O)c1cnc(Nc2ccc(C(O)(C([2H])([2H])[2H])C([2H])([2H])[2H])c(F)n2)cc1Nc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C22H24FN5O4S/c1-5-16(29)13-12-25-19(27-18-9-8-14(20(23)28-18)22(2,3)30)11-15(13)26-21-17(33(4,31)32)7-6-10-24-21/h6-12,30H,5H2,1-4H3,(H2,24,25,26,27,28)/i1D3,2D3,3D3 |
| InChIKey | IGFXZMYLPGZVOL-GQALSZNTSA-N |
| XLogP | 3.72 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|