About 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide
3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide (PubChem CID 15563989) has the molecular formula C7H6N6O
and a molecular weight of 190.17 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide |
| PubChem CID | 15563989 |
| Molecular Formula | C7H6N6O |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1nccnc1-n1cncn1 |
| InChI | InChI=1S/C7H6N6O/c8-6(14)5-7(11-2-1-10-5)13-4-9-3-12-13/h1-4H,(H2,8,14) |
| InChIKey | YTBSKHFNOLWEIY-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide?
The IUPAC name of 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide (CID 15563989) is 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide.
What is the SMILES notation for 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide?
The canonical SMILES for 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide is NC(=O)c1nccnc1-n1cncn1.
What is the InChIKey of 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide?
The InChIKey is YTBSKHFNOLWEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N6O/c8-6(14)5-7(11-2-1-10-5)13-4-9-3-12-13/h1-4H,(H2,8,14).
What are the key properties of 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide?
3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide has a molecular weight of 190.17 g/mol, XLogP of -0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-1-yl)pyrazine-2-carboxamide is sourced from PubChem (CID 15563989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).