C20H24BFO5S — CID 155639911
2-[2-(4-fluorophenoxy)-5-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155639911) has the molecular formula C20H24BFO5S and a molecular weight of 406.28 g/mol. Its IUPAC name is 2-[2-(4-fluorophenoxy)-5-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-(4-fluorophenoxy)-5-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155639911 |
| Molecular Formula | C20H24BFO5S |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[2-(4-fluorophenoxy)-5-(methylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(CS(C)(=O)=O)ccc2Oc2ccc(F)cc2)OC1(C)C |
| InChI | InChI=1S/C20H24BFO5S/c1-19(2)20(3,4)27-21(26-19)17-12-14(13-28(5,23)24)6-11-18(17)25-16-9-7-15(22)8-10-16/h6-12H,13H2,1-5H3 |
| InChIKey | OSJAXWQSHUUKPW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|