About 6-methylchrysene
6-methylchrysene (PubChem CID 15564) has the molecular formula C19H14
and a molecular weight of 242.32 g/mol. Its IUPAC name is 6-methylchrysene.
Molecular Properties
| Compound Name | 6-methylchrysene |
| PubChem CID | 15564 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 6-methylchrysene |
| SMILES | Cc1cc2c3ccccc3ccc2c2ccccc12 |
| InChI | InChI=1S/C19H14/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-12H,1H3 |
| InChIKey | ASVDRLYVNFOSCI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-methylchrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylchrysene?
The IUPAC name of 6-methylchrysene (CID 15564) is 6-methylchrysene.
What is the SMILES notation for 6-methylchrysene?
The canonical SMILES for 6-methylchrysene is Cc1cc2c3ccccc3ccc2c2ccccc12.
What is the InChIKey of 6-methylchrysene?
The InChIKey is ASVDRLYVNFOSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-12H,1H3.
What are the key properties of 6-methylchrysene?
6-methylchrysene has a molecular weight of 242.32 g/mol, XLogP of 5.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylchrysene is sourced from PubChem (CID 15564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).