C36H33NO2Si2 — CID 155641975
4-(3,4-dimethylphenyl)-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione (PubChem CID 155641975) has the molecular formula C36H33NO2Si2 and a molecular weight of 567.84 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione.
| Compound Name | 4-(3,4-dimethylphenyl)-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione |
|---|---|
| PubChem CID | 155641975 |
| Molecular Formula | C36H33NO2Si2 |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione |
| SMILES | Cc1ccc(-n2c(=O)c3c4cc([Si](C)(C)C)c5ccc6ccc7c([Si](C)(C)C)cc(c3c2=O)c2c7c6c5c42)cc1C |
| InChI | InChI=1S/C36H33NO2Si2/c1-18-9-12-21(15-19(18)2)37-35(38)33-24-16-26(40(3,4)5)22-13-10-20-11-14-23-27(41(6,7)8)17-25(34(33)36(37)39)32-30(23)28(20)29(22)31(24)32/h9-17H,1-8H3 |
| InChIKey | IPQDSSSVGUWHPU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|