C35H39NO2Si2 — CID 155642061
4-heptan-4-yl-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione (PubChem CID 155642061) has the molecular formula C35H39NO2Si2 and a molecular weight of 561.87 g/mol. Its IUPAC name is 4-heptan-4-yl-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione.
| Compound Name | 4-heptan-4-yl-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione |
|---|---|
| PubChem CID | 155642061 |
| Molecular Formula | C35H39NO2Si2 |
| Molecular Weight | 561.87 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 4-heptan-4-yl-9,23-bis(trimethylsilyl)-4-azaheptacyclo[14.5.2.02,6.07,20.010,19.013,18.017,21]tricosa-1(22),2(6),7,9,11,13(18),14,16(23),17(21),19-decaene-3,5-dione |
| SMILES | CCCC(CCC)n1c(=O)c2c3cc([Si](C)(C)C)c4ccc5ccc6c([Si](C)(C)C)cc(c2c1=O)c1c6c5c4c31 |
| InChI | InChI=1S/C35H39NO2Si2/c1-9-11-20(12-10-2)36-34(37)32-23-17-25(39(3,4)5)21-15-13-19-14-16-22-26(40(6,7)8)18-24(33(32)35(36)38)31-29(22)27(19)28(21)30(23)31/h13-18,20H,9-12H2,1-8H3 |
| InChIKey | QZHFVHPXFAQPOY-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|