(3-ethoxypyrazin-2-yl)boronic acid

C6H9BN2O3 — CID 155642145

IUPAC(3-ethoxypyrazin-2-yl)boronic acid
SMILESCCOc1nccnc1B(O)O
InChIInChI=1S/C6H9BN2O3/c1-2-12-6-5(7(10)11)8-3-4-9-6/h3-4,10-11H,2H2,1H3
InChIKeyRIBJLXWMQWKURK-UHFFFAOYSA-N
MW167.96 g/mol
LogP-1.44
Rot. Bonds3

About (3-ethoxypyrazin-2-yl)boronic acid

(3-ethoxypyrazin-2-yl)boronic acid (PubChem CID 155642145) has the molecular formula C6H9BN2O3 and a molecular weight of 167.96 g/mol. Its IUPAC name is (3-ethoxypyrazin-2-yl)boronic acid.

Molecular Properties

Compound Name(3-ethoxypyrazin-2-yl)boronic acid
PubChem CID155642145
Molecular FormulaC6H9BN2O3
Molecular Weight167.96 g/mol
Exact Mass168.07
IUPAC Name(3-ethoxypyrazin-2-yl)boronic acid
SMILESCCOc1nccnc1B(O)O
InChIInChI=1S/C6H9BN2O3/c1-2-12-6-5(7(10)11)8-3-4-9-6/h3-4,10-11H,2H2,1H3
InChIKeyRIBJLXWMQWKURK-UHFFFAOYSA-N
XLogP-1.44
TPSA75.47 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.96
LogP ≤ 5-1.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-ethoxypyrazin-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-ethoxypyrazin-2-yl)boronic acid?
The IUPAC name of (3-ethoxypyrazin-2-yl)boronic acid (CID 155642145) is (3-ethoxypyrazin-2-yl)boronic acid.
What is the SMILES notation for (3-ethoxypyrazin-2-yl)boronic acid?
The canonical SMILES for (3-ethoxypyrazin-2-yl)boronic acid is CCOc1nccnc1B(O)O.
What is the InChIKey of (3-ethoxypyrazin-2-yl)boronic acid?
The InChIKey is RIBJLXWMQWKURK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BN2O3/c1-2-12-6-5(7(10)11)8-3-4-9-6/h3-4,10-11H,2H2,1H3.
What are the key properties of (3-ethoxypyrazin-2-yl)boronic acid?
(3-ethoxypyrazin-2-yl)boronic acid has a molecular weight of 167.96 g/mol, XLogP of -1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxypyrazin-2-yl)boronic acid is sourced from PubChem (CID 155642145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).