C26H36O4S2Si — CID 155642227
(4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-3,3-diethoxypropyl]-1,3-oxathiolane-2-thione (PubChem CID 155642227) has the molecular formula C26H36O4S2Si and a molecular weight of 504.79 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-3,3-diethoxypropyl]-1,3-oxathiolane-2-thione.
| Compound Name | (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-3,3-diethoxypropyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 155642227 |
| Molecular Formula | C26H36O4S2Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (4R)-4-[(1S)-1-[tert-butyl(diphenyl)silyl]oxy-3,3-diethoxypropyl]-1,3-oxathiolane-2-thione |
| SMILES | CCOC(C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(=S)S1)OCC |
| InChI | InChI=1S/C26H36O4S2Si/c1-6-27-24(28-7-2)18-22(23-19-29-25(31)32-23)30-33(26(3,4)5,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-24H,6-7,18-19H2,1-5H3/t22-,23+/m0/s1 |
| InChIKey | ZVOUTXZDMHWTIS-XZOQPEGZSA-N |
| XLogP | 5.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|