About tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane
tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane (PubChem CID 155642232) has the molecular formula C25H36O3SSi
and a molecular weight of 444.71 g/mol. Its IUPAC name is tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane |
| PubChem CID | 155642232 |
| Molecular Formula | C25H36O3SSi |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane |
| SMILES | CCOC(C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CS1)OCC |
| InChI | InChI=1S/C25H36O3SSi/c1-6-26-24(27-7-2)18-22(23-19-29-23)28-30(25(3,4)5,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-24H,6-7,18-19H2,1-5H3/t22-,23+/m0/s1 |
| InChIKey | HLANPBDETMAMAU-XZOQPEGZSA-N |
| XLogP | 4.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane (CID 155642232) is tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane is CCOC(C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CS1)OCC.
What is the InChIKey of tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane?
The InChIKey is HLANPBDETMAMAU-XZOQPEGZSA-N. The full InChI is InChI=1S/C25H36O3SSi/c1-6-26-24(27-7-2)18-22(23-19-29-23)28-30(25(3,4)5,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-24H,6-7,18-19H2,1-5H3/t22-,23+/m0/s1.
What are the key properties of tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane?
tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane has a molecular weight of 444.71 g/mol, XLogP of 4.84, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S)-3,3-diethoxy-1-[(2S)-thiiran-2-yl]propoxy]-diphenylsilane is sourced from PubChem (CID 155642232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).