About 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+)
6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) (PubChem CID 155642511) has the molecular formula C13H18N2OW
and a molecular weight of 402.14 g/mol. Its IUPAC name is 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+).
Molecular Properties
| Compound Name | 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) |
| PubChem CID | 155642511 |
| Molecular Formula | C13H18N2OW |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) |
| SMILES | CC(C)(C)c1cc2oncc2[c-]n1.C[CH-]C.[W+2] |
| InChI | InChI=1S/C10H11N2O.C3H7.W/c1-10(2,3)9-4-8-7(5-11-9)6-12-13-8;1-3-2;/h4,6H,1-3H3;3H,1-2H3;/q2*-1;+2 |
| InChIKey | HMOYLANWTYCYED-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+)?
The IUPAC name of 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) (CID 155642511) is 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+).
What is the SMILES notation for 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+)?
The canonical SMILES for 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) is CC(C)(C)c1cc2oncc2[c-]n1.C[CH-]C.[W+2].
What is the InChIKey of 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+)?
The InChIKey is HMOYLANWTYCYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N2O.C3H7.W/c1-10(2,3)9-4-8-7(5-11-9)6-12-13-8;1-3-2;/h4,6H,1-3H3;3H,1-2H3;/q2*-1;+2.
What are the key properties of 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+)?
6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) has a molecular weight of 402.14 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-4H-[1,2]oxazolo[4,5-c]pyridin-4-ide;propane;tungsten(2+) is sourced from PubChem (CID 155642511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).